C13H14FN3 — CID 55067572
2-(5-fluoro-2-methylphenyl)-5,6-dimethylpyrimidin-4-amine (PubChem CID 55067572) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-5,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-5,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 55067572 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-5,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1ccc(F)cc1-c1nc(C)c(C)c(N)n1 |
| InChI | InChI=1S/C13H14FN3/c1-7-4-5-10(14)6-11(7)13-16-9(3)8(2)12(15)17-13/h4-6H,1-3H3,(H2,15,16,17) |
| InChIKey | SOYKOVYLBVSZIL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |