About 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline
5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline (PubChem CID 55067916) has the molecular formula C11H10FN3O2S
and a molecular weight of 267.29 g/mol. Its IUPAC name is 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline.
Molecular Properties
| Compound Name | 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline |
| PubChem CID | 55067916 |
| Molecular Formula | C11H10FN3O2S |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline |
| SMILES | Cc1ncc(CNc2cc(F)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H10FN3O2S/c1-7-13-5-9(18-7)6-14-10-4-8(12)2-3-11(10)15(16)17/h2-5,14H,6H2,1H3 |
| InChIKey | OUFZUPMRTGLEIV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline?
The IUPAC name of 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline (CID 55067916) is 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline.
What is the SMILES notation for 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline?
The canonical SMILES for 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline is Cc1ncc(CNc2cc(F)ccc2[N+](=O)[O-])s1.
What is the InChIKey of 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline?
The InChIKey is OUFZUPMRTGLEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3O2S/c1-7-13-5-9(18-7)6-14-10-4-8(12)2-3-11(10)15(16)17/h2-5,14H,6H2,1H3.
What are the key properties of 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline?
5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline has a molecular weight of 267.29 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2-nitroaniline is sourced from PubChem (CID 55067916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).