About ethyl 2-isocyanatopropanoate
ethyl 2-isocyanatopropanoate (PubChem CID 550681) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is ethyl 2-isocyanatopropanoate.
Molecular Properties
| Compound Name | ethyl 2-isocyanatopropanoate |
| PubChem CID | 550681 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | ethyl 2-isocyanatopropanoate |
| SMILES | CCOC(=O)C(C)N=C=O |
| InChI | InChI=1S/C6H9NO3/c1-3-10-6(9)5(2)7-4-8/h5H,3H2,1-2H3 |
| InChIKey | PFIQRPNWLUAMOF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-isocyanatopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-isocyanatopropanoate?
The IUPAC name of ethyl 2-isocyanatopropanoate (CID 550681) is ethyl 2-isocyanatopropanoate.
What is the SMILES notation for ethyl 2-isocyanatopropanoate?
The canonical SMILES for ethyl 2-isocyanatopropanoate is CCOC(=O)C(C)N=C=O.
What is the InChIKey of ethyl 2-isocyanatopropanoate?
The InChIKey is PFIQRPNWLUAMOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-3-10-6(9)5(2)7-4-8/h5H,3H2,1-2H3.
What are the key properties of ethyl 2-isocyanatopropanoate?
ethyl 2-isocyanatopropanoate has a molecular weight of 143.14 g/mol, XLogP of 0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-isocyanatopropanoate is sourced from PubChem (CID 550681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).