C9H5Br2F3N2O — CID 55068416
5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 55068416) has the molecular formula C9H5Br2F3N2O and a molecular weight of 373.95 g/mol. Its IUPAC name is 5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 55068416 |
| Molecular Formula | C9H5Br2F3N2O |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 371.87 |
| IUPAC Name | 5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(C(Br)C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C9H5Br2F3N2O/c10-4-2-6-5(15-8(17)16-6)1-3(4)7(11)9(12,13)14/h1-2,7H,(H2,15,16,17) |
| InChIKey | AEWKFAPZZUGCKJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|