C15H17NO5 — CID 550685
3,3,5,5-tetramethyl-6-(4-nitrophenyl)oxane-2,4-dione (PubChem CID 550685) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-6-(4-nitrophenyl)oxane-2,4-dione.
| Compound Name | 3,3,5,5-tetramethyl-6-(4-nitrophenyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 550685 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3,3,5,5-tetramethyl-6-(4-nitrophenyl)oxane-2,4-dione |
| SMILES | CC1(C)C(=O)OC(c2ccc([N+](=O)[O-])cc2)C(C)(C)C1=O |
| InChI | InChI=1S/C15H17NO5/c1-14(2)11(21-13(18)15(3,4)12(14)17)9-5-7-10(8-6-9)16(19)20/h5-8,11H,1-4H3 |
| InChIKey | ZRDYCSSILVXCHI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|