About 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one
3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 550690) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one |
| PubChem CID | 550690 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | CC1(C)C(=O)C=C(O)C=C1O |
| InChI | InChI=1S/C8H10O3/c1-8(2)6(10)3-5(9)4-7(8)11/h3-4,9-10H,1-2H3 |
| InChIKey | ZAQQZMZXYOTJAB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
The IUPAC name of 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one (CID 550690) is 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one is CC1(C)C(=O)C=C(O)C=C1O.
What is the InChIKey of 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
The InChIKey is ZAQQZMZXYOTJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-8(2)6(10)3-5(9)4-7(8)11/h3-4,9-10H,1-2H3.
What are the key properties of 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one?
3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one has a molecular weight of 154.16 g/mol, XLogP of 1.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxy-6,6-dimethylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 550690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).