About N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine
N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine (PubChem CID 55069938) has the molecular formula C17H28N2
and a molecular weight of 260.42 g/mol. Its IUPAC name is N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine |
| PubChem CID | 55069938 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine |
| SMILES | CCCCN(CC)C(CNC1CC1)c1ccccc1 |
| InChI | InChI=1S/C17H28N2/c1-3-5-13-19(4-2)17(14-18-16-11-12-16)15-9-7-6-8-10-15/h6-10,16-18H,3-5,11-14H2,1-2H3 |
| InChIKey | TXWKHPYJGCRVCS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine?
The IUPAC name of N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine (CID 55069938) is N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine.
What is the SMILES notation for N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine?
The canonical SMILES for N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine is CCCCN(CC)C(CNC1CC1)c1ccccc1.
What is the InChIKey of N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine?
The InChIKey is TXWKHPYJGCRVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-3-5-13-19(4-2)17(14-18-16-11-12-16)15-9-7-6-8-10-15/h6-10,16-18H,3-5,11-14H2,1-2H3.
What are the key properties of N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine?
N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine has a molecular weight of 260.42 g/mol, XLogP of 3.60, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-cyclopropyl-N-ethyl-1-phenylethane-1,2-diamine is sourced from PubChem (CID 55069938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).