About N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine
N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine (PubChem CID 55070524) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine |
| PubChem CID | 55070524 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine |
| SMILES | COCCN(CCCNC1CC1)C(C)COC |
| InChI | InChI=1S/C13H28N2O2/c1-12(11-17-3)15(9-10-16-2)8-4-7-14-13-5-6-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | TXCONADSSXFTMS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine?
The IUPAC name of N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine (CID 55070524) is N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine.
What is the SMILES notation for N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine?
The canonical SMILES for N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine is COCCN(CCCNC1CC1)C(C)COC.
What is the InChIKey of N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine?
The InChIKey is TXCONADSSXFTMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-12(11-17-3)15(9-10-16-2)8-4-7-14-13-5-6-13/h12-14H,4-11H2,1-3H3.
What are the key properties of N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine?
N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine has a molecular weight of 244.38 g/mol, XLogP of 1.11, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-(2-methoxyethyl)-N'-(1-methoxypropan-2-yl)propane-1,3-diamine is sourced from PubChem (CID 55070524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).