About [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine
[3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine (PubChem CID 55070584) has the molecular formula C13H16FN3S
and a molecular weight of 265.36 g/mol. Its IUPAC name is [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine.
Molecular Properties
| Compound Name | [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine |
| PubChem CID | 55070584 |
| Molecular Formula | C13H16FN3S |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine |
| SMILES | Cc1cc(SCc2cc(CN)ccc2F)n(C)n1 |
| InChI | InChI=1S/C13H16FN3S/c1-9-5-13(17(2)16-9)18-8-11-6-10(7-15)3-4-12(11)14/h3-6H,7-8,15H2,1-2H3 |
| InChIKey | QVVPIYABZAKWJY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine?
The IUPAC name of [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine (CID 55070584) is [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine.
What is the SMILES notation for [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine?
The canonical SMILES for [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine is Cc1cc(SCc2cc(CN)ccc2F)n(C)n1.
What is the InChIKey of [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine?
The InChIKey is QVVPIYABZAKWJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FN3S/c1-9-5-13(17(2)16-9)18-8-11-6-10(7-15)3-4-12(11)14/h3-6H,7-8,15H2,1-2H3.
What are the key properties of [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine?
[3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine has a molecular weight of 265.36 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-4-fluorophenyl]methanamine is sourced from PubChem (CID 55070584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).