C13H14ClN5 — CID 55071441
2-[[4-(2-chloroethyl)triazol-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine (PubChem CID 55071441) has the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-[[4-(2-chloroethyl)triazol-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-[[4-(2-chloroethyl)triazol-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 55071441 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[[4-(2-chloroethyl)triazol-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc2nc(Cn3cc(CCCl)nn3)cn2c1 |
| InChI | InChI=1S/C13H14ClN5/c1-10-2-3-13-15-12(7-18(13)6-10)9-19-8-11(4-5-14)16-17-19/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | KEFRZCVZPOQSKP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|