About 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole
2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole (PubChem CID 55071824) has the molecular formula C13H11BrN4O
and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole |
| PubChem CID | 55071824 |
| Molecular Formula | C13H11BrN4O |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole |
| SMILES | BrCc1cn(Cc2ncc(-c3ccccc3)o2)nn1 |
| InChI | InChI=1S/C13H11BrN4O/c14-6-11-8-18(17-16-11)9-13-15-7-12(19-13)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2 |
| InChIKey | ACTKNSASIZRFKC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole?
The IUPAC name of 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole (CID 55071824) is 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole.
What is the SMILES notation for 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole?
The canonical SMILES for 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole is BrCc1cn(Cc2ncc(-c3ccccc3)o2)nn1.
What is the InChIKey of 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole?
The InChIKey is ACTKNSASIZRFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN4O/c14-6-11-8-18(17-16-11)9-13-15-7-12(19-13)10-4-2-1-3-5-10/h1-5,7-8H,6,9H2.
What are the key properties of 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole?
2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole has a molecular weight of 319.16 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(bromomethyl)triazol-1-yl]methyl]-5-phenyl-1,3-oxazole is sourced from PubChem (CID 55071824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).