C15H18BrNO — CID 55071926
3-(2-bromo-4,4-dimethyl-3-oxopentyl)-4-methylbenzonitrile (PubChem CID 55071926) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 3-(2-bromo-4,4-dimethyl-3-oxopentyl)-4-methylbenzonitrile.
| Compound Name | 3-(2-bromo-4,4-dimethyl-3-oxopentyl)-4-methylbenzonitrile |
|---|---|
| PubChem CID | 55071926 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-(2-bromo-4,4-dimethyl-3-oxopentyl)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1CC(Br)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H18BrNO/c1-10-5-6-11(9-17)7-12(10)8-13(16)14(18)15(2,3)4/h5-7,13H,8H2,1-4H3 |
| InChIKey | RYOSWTNJIFGBDZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|