C14H23N3OS — CID 55072692
1-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]-N-methylmethanamine (PubChem CID 55072692) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]-N-methylmethanamine.
| Compound Name | 1-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 55072692 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-[4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-1,3-thiazol-2-yl]-N-methylmethanamine |
| SMILES | CNCc1nc(CN2CCOC3CCCCC32)cs1 |
| InChI | InChI=1S/C14H23N3OS/c1-15-8-14-16-11(10-19-14)9-17-6-7-18-13-5-3-2-4-12(13)17/h10,12-13,15H,2-9H2,1H3 |
| InChIKey | CQOZRKNBCBFISQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |