C14H24N2O2 — CID 55073433
N-[[3-[(1-methylpiperidin-4-yl)oxymethyl]furan-2-yl]methyl]ethanamine (PubChem CID 55073433) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[[3-[(1-methylpiperidin-4-yl)oxymethyl]furan-2-yl]methyl]ethanamine.
| Compound Name | N-[[3-[(1-methylpiperidin-4-yl)oxymethyl]furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 55073433 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-[[3-[(1-methylpiperidin-4-yl)oxymethyl]furan-2-yl]methyl]ethanamine |
| SMILES | CCNCc1occc1COC1CCN(C)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-3-15-10-14-12(6-9-17-14)11-18-13-4-7-16(2)8-5-13/h6,9,13,15H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | TURLXVQKDJVPRK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |