C11H16BrN5S — CID 55073990
2-[4-(aminomethyl)triazol-1-yl]-N-[(4-bromothiophen-2-yl)methyl]-N-methylethanamine (PubChem CID 55073990) has the molecular formula C11H16BrN5S and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-[(4-bromothiophen-2-yl)methyl]-N-methylethanamine.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[(4-bromothiophen-2-yl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 55073990 |
| Molecular Formula | C11H16BrN5S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-[(4-bromothiophen-2-yl)methyl]-N-methylethanamine |
| SMILES | CN(CCn1cc(CN)nn1)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H16BrN5S/c1-16(7-11-4-9(12)8-18-11)2-3-17-6-10(5-13)14-15-17/h4,6,8H,2-3,5,7,13H2,1H3 |
| InChIKey | DCIFOLWPOAOEPQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |