About N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine
N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine (PubChem CID 55074837) has the molecular formula C14H30N2S
and a molecular weight of 258.47 g/mol. Its IUPAC name is N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine |
| PubChem CID | 55074837 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine |
| SMILES | CN(CCCCCNC(C)(C)C)C1CCSC1 |
| InChI | InChI=1S/C14H30N2S/c1-14(2,3)15-9-6-5-7-10-16(4)13-8-11-17-12-13/h13,15H,5-12H2,1-4H3 |
| InChIKey | IYLBVTJIFPXBSQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine?
The IUPAC name of N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine (CID 55074837) is N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine.
What is the SMILES notation for N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine?
The canonical SMILES for N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine is CN(CCCCCNC(C)(C)C)C1CCSC1.
What is the InChIKey of N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine?
The InChIKey is IYLBVTJIFPXBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2S/c1-14(2,3)15-9-6-5-7-10-16(4)13-8-11-17-12-13/h13,15H,5-12H2,1-4H3.
What are the key properties of N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine?
N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine has a molecular weight of 258.47 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-methyl-N'-(thiolan-3-yl)pentane-1,5-diamine is sourced from PubChem (CID 55074837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).