C11H16F3N3 — CID 55075177
4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]pyridin-2-amine (PubChem CID 55075177) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]pyridin-2-amine.
| Compound Name | 4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55075177 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]pyridin-2-amine |
| SMILES | CCCN(Cc1ccnc(N)c1)CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3/c1-2-5-17(8-11(12,13)14)7-9-3-4-16-10(15)6-9/h3-4,6H,2,5,7-8H2,1H3,(H2,15,16) |
| InChIKey | PDLMILMAPWQHMH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |