C16H27N3 — CID 55075363
4-[[cyclopentyl(ethyl)amino]methyl]-N-propylpyridin-2-amine (PubChem CID 55075363) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-[[cyclopentyl(ethyl)amino]methyl]-N-propylpyridin-2-amine.
| Compound Name | 4-[[cyclopentyl(ethyl)amino]methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 55075363 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 4-[[cyclopentyl(ethyl)amino]methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(CN(CC)C2CCCC2)ccn1 |
| InChI | InChI=1S/C16H27N3/c1-3-10-17-16-12-14(9-11-18-16)13-19(4-2)15-7-5-6-8-15/h9,11-12,15H,3-8,10,13H2,1-2H3,(H,17,18) |
| InChIKey | PEFZGDFMXKQFTC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |