About 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one
2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one (PubChem CID 550757) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one |
| PubChem CID | 550757 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)C1OC(=O)C(C)(C(C)(C)O)O1 |
| InChI | InChI=1S/C11H20O4/c1-9(2,3)8-14-7(12)11(6,15-8)10(4,5)13/h8,13H,1-6H3 |
| InChIKey | YIBYNFQYSZJTTC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one?
The IUPAC name of 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one (CID 550757) is 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one.
What is the SMILES notation for 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one?
The canonical SMILES for 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one is CC(C)(C)C1OC(=O)C(C)(C(C)(C)O)O1.
What is the InChIKey of 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one?
The InChIKey is YIBYNFQYSZJTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-9(2,3)8-14-7(12)11(6,15-8)10(4,5)13/h8,13H,1-6H3.
What are the key properties of 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one?
2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one has a molecular weight of 216.28 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2-hydroxypropan-2-yl)-5-methyl-1,3-dioxolan-4-one is sourced from PubChem (CID 550757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).