C16H23NO2 — CID 55075882
2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-1-(2-methylphenyl)ethanone (PubChem CID 55075882) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-1-(2-methylphenyl)ethanone.
| Compound Name | 2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-1-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 55075882 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-1-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1C(=O)CN1CCCC1CCCO |
| InChI | InChI=1S/C16H23NO2/c1-13-6-2-3-9-15(13)16(19)12-17-10-4-7-14(17)8-5-11-18/h2-3,6,9,14,18H,4-5,7-8,10-12H2,1H3 |
| InChIKey | UPTMHUQSELGXGU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |