C10H14F4N2O2 — CID 55077556
N-[[5-(2,2,3,3-tetrafluoropropoxymethyl)-1,2-oxazol-3-yl]methyl]ethanamine (PubChem CID 55077556) has the molecular formula C10H14F4N2O2 and a molecular weight of 270.23 g/mol. Its IUPAC name is N-[[5-(2,2,3,3-tetrafluoropropoxymethyl)-1,2-oxazol-3-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,2,3,3-tetrafluoropropoxymethyl)-1,2-oxazol-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 55077556 |
| Molecular Formula | C10H14F4N2O2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-[[5-(2,2,3,3-tetrafluoropropoxymethyl)-1,2-oxazol-3-yl]methyl]ethanamine |
| SMILES | CCNCc1cc(COCC(F)(F)C(F)F)on1 |
| InChI | InChI=1S/C10H14F4N2O2/c1-2-15-4-7-3-8(18-16-7)5-17-6-10(13,14)9(11)12/h3,9,15H,2,4-6H2,1H3 |
| InChIKey | SHZGCMKHMBTVKC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|