About 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine
1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine (PubChem CID 55078352) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine |
| PubChem CID | 55078352 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine |
| SMILES | Cc1cc(CNCC(C)(N)c2ccccc2)no1 |
| InChI | InChI=1S/C14H19N3O/c1-11-8-13(17-18-11)9-16-10-14(2,15)12-6-4-3-5-7-12/h3-8,16H,9-10,15H2,1-2H3 |
| InChIKey | NCULZFDXTFDMPS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine?
The IUPAC name of 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine (CID 55078352) is 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine.
What is the SMILES notation for 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine?
The canonical SMILES for 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine is Cc1cc(CNCC(C)(N)c2ccccc2)no1.
What is the InChIKey of 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine?
The InChIKey is NCULZFDXTFDMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-11-8-13(17-18-11)9-16-10-14(2,15)12-6-4-3-5-7-12/h3-8,16H,9-10,15H2,1-2H3.
What are the key properties of 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine?
1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine has a molecular weight of 245.33 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-phenylpropane-1,2-diamine is sourced from PubChem (CID 55078352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).