About 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide
2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (PubChem CID 55079465) has the molecular formula C12H15ClF3N3
and a molecular weight of 293.72 g/mol. Its IUPAC name is 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
Molecular Properties
| Compound Name | 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| PubChem CID | 55079465 |
| Molecular Formula | C12H15ClF3N3 |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1N(CCC)CC(F)(F)F |
| InChI | InChI=1S/C12H15ClF3N3/c1-2-6-19(7-12(14,15)16)9-5-3-4-8(13)10(9)11(17)18/h3-5H,2,6-7H2,1H3,(H3,17,18) |
| InChIKey | NGAYCVIDVIHHLL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
The IUPAC name of 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (CID 55079465) is 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
What is the SMILES notation for 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
The canonical SMILES for 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide is [H]/N=C(\N)c1c(Cl)cccc1N(CCC)CC(F)(F)F.
What is the InChIKey of 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
The InChIKey is NGAYCVIDVIHHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF3N3/c1-2-6-19(7-12(14,15)16)9-5-3-4-8(13)10(9)11(17)18/h3-5H,2,6-7H2,1H3,(H3,17,18).
What are the key properties of 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide?
2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide has a molecular weight of 293.72 g/mol, XLogP of 3.40, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[propyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide is sourced from PubChem (CID 55079465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).