C12H9Cl2N3O2 — CID 55079880
1-N-(3,5-dichlorophenyl)-4-nitrobenzene-1,2-diamine (PubChem CID 55079880) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 1-N-(3,5-dichlorophenyl)-4-nitrobenzene-1,2-diamine.
| Compound Name | 1-N-(3,5-dichlorophenyl)-4-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 55079880 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 1-N-(3,5-dichlorophenyl)-4-nitrobenzene-1,2-diamine |
| SMILES | Nc1cc([N+](=O)[O-])ccc1Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c13-7-3-8(14)5-9(4-7)16-12-2-1-10(17(18)19)6-11(12)15/h1-6,16H,15H2 |
| InChIKey | KTMJEXSTIAPGEU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|