About 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine
4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine (PubChem CID 55080102) has the molecular formula C11H7ClF2N2S
and a molecular weight of 272.71 g/mol. Its IUPAC name is 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine |
| PubChem CID | 55080102 |
| Molecular Formula | C11H7ClF2N2S |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine |
| SMILES | Cc1nc(Cl)cc(Sc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C11H7ClF2N2S/c1-6-15-10(12)5-11(16-6)17-9-4-7(13)2-3-8(9)14/h2-5H,1H3 |
| InChIKey | KUHNNGQKDPQBCW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine?
The IUPAC name of 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine (CID 55080102) is 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine.
What is the SMILES notation for 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine?
The canonical SMILES for 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine is Cc1nc(Cl)cc(Sc2cc(F)ccc2F)n1.
What is the InChIKey of 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine?
The InChIKey is KUHNNGQKDPQBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClF2N2S/c1-6-15-10(12)5-11(16-6)17-9-4-7(13)2-3-8(9)14/h2-5H,1H3.
What are the key properties of 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine?
4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine has a molecular weight of 272.71 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(2,5-difluorophenyl)sulfanyl-2-methylpyrimidine is sourced from PubChem (CID 55080102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).