C13H15Cl3N2S — CID 55081372
4,4-diethyl-N-(2,4,5-trichlorophenyl)-5H-1,3-thiazol-2-amine (PubChem CID 55081372) has the molecular formula C13H15Cl3N2S and a molecular weight of 337.70 g/mol. Its IUPAC name is 4,4-diethyl-N-(2,4,5-trichlorophenyl)-5H-1,3-thiazol-2-amine.
| Compound Name | 4,4-diethyl-N-(2,4,5-trichlorophenyl)-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 55081372 |
| Molecular Formula | C13H15Cl3N2S |
| Molecular Weight | 337.70 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4,4-diethyl-N-(2,4,5-trichlorophenyl)-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2cc(Cl)c(Cl)cc2Cl)=N1 |
| InChI | InChI=1S/C13H15Cl3N2S/c1-3-13(4-2)7-19-12(18-13)17-11-6-9(15)8(14)5-10(11)16/h5-6H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | QAOUCXWYLLYVNM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|