About N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine
N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine (PubChem CID 55084035) has the molecular formula C14H29NO3S
and a molecular weight of 291.46 g/mol. Its IUPAC name is N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine |
| PubChem CID | 55084035 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine |
| SMILES | CCOCCC(CNC(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H29NO3S/c1-5-18-8-6-12(10-15-14(2,3)4)13-7-9-19(16,17)11-13/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | RNIXXDTWUWFFDL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine?
The IUPAC name of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine (CID 55084035) is N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine.
What is the SMILES notation for N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine?
The canonical SMILES for N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine is CCOCCC(CNC(C)(C)C)C1CCS(=O)(=O)C1.
What is the InChIKey of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine?
The InChIKey is RNIXXDTWUWFFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3S/c1-5-18-8-6-12(10-15-14(2,3)4)13-7-9-19(16,17)11-13/h12-13,15H,5-11H2,1-4H3.
What are the key properties of N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine?
N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine has a molecular weight of 291.46 g/mol, XLogP of 1.85, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(1,1-dioxothiolan-3-yl)-4-ethoxybutan-1-amine is sourced from PubChem (CID 55084035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).