About 2-isocyanatobutane
2-isocyanatobutane (PubChem CID 550850) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 2-isocyanatobutane.
Molecular Properties
| Compound Name | 2-isocyanatobutane |
| PubChem CID | 550850 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 2-isocyanatobutane |
| SMILES | CCC(C)N=C=O |
| InChI | InChI=1S/C5H9NO/c1-3-5(2)6-4-7/h5H,3H2,1-2H3 |
| InChIKey | DUUSMHZSZWMNCB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatobutane?
The IUPAC name of 2-isocyanatobutane (CID 550850) is 2-isocyanatobutane.
What is the SMILES notation for 2-isocyanatobutane?
The canonical SMILES for 2-isocyanatobutane is CCC(C)N=C=O.
What is the InChIKey of 2-isocyanatobutane?
The InChIKey is DUUSMHZSZWMNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-3-5(2)6-4-7/h5H,3H2,1-2H3.
What are the key properties of 2-isocyanatobutane?
2-isocyanatobutane has a molecular weight of 99.13 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatobutane is sourced from PubChem (CID 550850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).