About N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine
N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine (PubChem CID 55085467) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine |
| PubChem CID | 55085467 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine |
| SMILES | CN(CCNCCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H26N2/c1-15(2,3)10-11-16-12-13-17(4)14-8-6-5-7-9-14/h5-9,16H,10-13H2,1-4H3 |
| InChIKey | RZRXZEHXDGURLH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine?
The IUPAC name of N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine (CID 55085467) is N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine.
What is the SMILES notation for N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine?
The canonical SMILES for N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine is CN(CCNCCC(C)(C)C)c1ccccc1.
What is the InChIKey of N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine?
The InChIKey is RZRXZEHXDGURLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2/c1-15(2,3)10-11-16-12-13-17(4)14-8-6-5-7-9-14/h5-9,16H,10-13H2,1-4H3.
What are the key properties of N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine?
N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine has a molecular weight of 234.39 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutyl)-N'-methyl-N'-phenylethane-1,2-diamine is sourced from PubChem (CID 55085467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).