C13H11ClN2O2S — CID 55085549
2-(7-chloro-1,3-benzodioxol-5-yl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 55085549) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 55085549 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Clc1cc(-c2nc3c(s2)CNCC3)cc2c1OCO2 |
| InChI | InChI=1S/C13H11ClN2O2S/c14-8-3-7(4-10-12(8)18-6-17-10)13-16-9-1-2-15-5-11(9)19-13/h3-4,15H,1-2,5-6H2 |
| InChIKey | DROXZFPALGXQSX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |