About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline (PubChem CID 55085836) has the molecular formula C12H11F2N3S
and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline |
| PubChem CID | 55085836 |
| Molecular Formula | C12H11F2N3S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline |
| SMILES | Cc1cc(C)nc(Sc2c(N)ccc(F)c2F)n1 |
| InChI | InChI=1S/C12H11F2N3S/c1-6-5-7(2)17-12(16-6)18-11-9(15)4-3-8(13)10(11)14/h3-5H,15H2,1-2H3 |
| InChIKey | SZCHYFBSOODQLI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline (CID 55085836) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline is Cc1cc(C)nc(Sc2c(N)ccc(F)c2F)n1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline?
The InChIKey is SZCHYFBSOODQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2N3S/c1-6-5-7(2)17-12(16-6)18-11-9(15)4-3-8(13)10(11)14/h3-5H,15H2,1-2H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline has a molecular weight of 267.30 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3,4-difluoroaniline is sourced from PubChem (CID 55085836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).