About 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione
3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione (PubChem CID 55085883) has the molecular formula C11H10F2N2O2S2
and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione |
| PubChem CID | 55085883 |
| Molecular Formula | C11H10F2N2O2S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione |
| SMILES | O=S1(=O)CCC(n2c(=S)[nH]c3ccc(F)c(F)c32)C1 |
| InChI | InChI=1S/C11H10F2N2O2S2/c12-7-1-2-8-10(9(7)13)15(11(18)14-8)6-3-4-19(16,17)5-6/h1-2,6H,3-5H2,(H,14,18) |
| InChIKey | YWERZGFJLICIMZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione (CID 55085883) is 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione is O=S1(=O)CCC(n2c(=S)[nH]c3ccc(F)c(F)c32)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione?
The InChIKey is YWERZGFJLICIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2O2S2/c12-7-1-2-8-10(9(7)13)15(11(18)14-8)6-3-4-19(16,17)5-6/h1-2,6H,3-5H2,(H,14,18).
What are the key properties of 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione?
3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione has a molecular weight of 304.34 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)-4,5-difluoro-1H-benzimidazole-2-thione is sourced from PubChem (CID 55085883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).