About 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine
3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine (PubChem CID 55086406) has the molecular formula C15H16F2N2
and a molecular weight of 262.30 g/mol. Its IUPAC name is 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine |
| PubChem CID | 55086406 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine |
| SMILES | CC(C)c1ccccc1Nc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C15H16F2N2/c1-9(2)10-5-3-4-6-13(10)19-15-12(18)8-7-11(16)14(15)17/h3-9,19H,18H2,1-2H3 |
| InChIKey | GGCRUDQEVDSQLP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine?
The IUPAC name of 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine (CID 55086406) is 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine.
What is the SMILES notation for 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine?
The canonical SMILES for 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine is CC(C)c1ccccc1Nc1c(N)ccc(F)c1F.
What is the InChIKey of 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine?
The InChIKey is GGCRUDQEVDSQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2/c1-9(2)10-5-3-4-6-13(10)19-15-12(18)8-7-11(16)14(15)17/h3-9,19H,18H2,1-2H3.
What are the key properties of 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine?
3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine has a molecular weight of 262.30 g/mol, XLogP of 4.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluoro-2-N-(2-propan-2-ylphenyl)benzene-1,2-diamine is sourced from PubChem (CID 55086406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).