About methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate
methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate (PubChem CID 55086421) has the molecular formula C12H11ClF2N2O2
and a molecular weight of 288.68 g/mol. Its IUPAC name is methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate |
| PubChem CID | 55086421 |
| Molecular Formula | C12H11ClF2N2O2 |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate |
| SMILES | COC(=O)CCn1c(CCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C12H11ClF2N2O2/c1-19-10(18)4-5-17-9(6-13)16-8-3-2-7(14)11(15)12(8)17/h2-3H,4-6H2,1H3 |
| InChIKey | ANSCVCHPJAXPMV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate?
The IUPAC name of methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate (CID 55086421) is methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate.
What is the SMILES notation for methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate?
The canonical SMILES for methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate is COC(=O)CCn1c(CCl)nc2ccc(F)c(F)c21.
What is the InChIKey of methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate?
The InChIKey is ANSCVCHPJAXPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2N2O2/c1-19-10(18)4-5-17-9(6-13)16-8-3-2-7(14)11(15)12(8)17/h2-3H,4-6H2,1H3.
What are the key properties of methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate?
methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate has a molecular weight of 288.68 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]propanoate is sourced from PubChem (CID 55086421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).