About N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine
N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine (PubChem CID 55086446) has the molecular formula C10H15N7
and a molecular weight of 233.28 g/mol. Its IUPAC name is N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine |
| PubChem CID | 55086446 |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine |
| SMILES | CNC1CCCN(c2cncc3nnnn23)C1 |
| InChI | InChI=1S/C10H15N7/c1-11-8-3-2-4-16(7-8)10-6-12-5-9-13-14-15-17(9)10/h5-6,8,11H,2-4,7H2,1H3 |
| InChIKey | GBJZUGZDYBTUNB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine?
The IUPAC name of N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine (CID 55086446) is N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine.
What is the SMILES notation for N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine?
The canonical SMILES for N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine is CNC1CCCN(c2cncc3nnnn23)C1.
What is the InChIKey of N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine?
The InChIKey is GBJZUGZDYBTUNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N7/c1-11-8-3-2-4-16(7-8)10-6-12-5-9-13-14-15-17(9)10/h5-6,8,11H,2-4,7H2,1H3.
What are the key properties of N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine?
N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine has a molecular weight of 233.28 g/mol, XLogP of -0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(tetrazolo[1,5-a]pyrazin-5-yl)piperidin-3-amine is sourced from PubChem (CID 55086446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).