About [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol
[1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol (PubChem CID 55086895) has the molecular formula C12H23NO3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol |
| PubChem CID | 55086895 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol |
| SMILES | CC1CCCC(CO)(NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C12H23NO3S/c1-10-3-2-5-12(7-10,9-14)13-11-4-6-17(15,16)8-11/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | LTBYSNLHKZIVOW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol?
The IUPAC name of [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol (CID 55086895) is [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol.
What is the SMILES notation for [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol?
The canonical SMILES for [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol is CC1CCCC(CO)(NC2CCS(=O)(=O)C2)C1.
What is the InChIKey of [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol?
The InChIKey is LTBYSNLHKZIVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3S/c1-10-3-2-5-12(7-10,9-14)13-11-4-6-17(15,16)8-11/h10-11,13-14H,2-9H2,1H3.
What are the key properties of [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol?
[1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol has a molecular weight of 261.39 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1,1-dioxothiolan-3-yl)amino]-3-methylcyclohexyl]methanol is sourced from PubChem (CID 55086895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).