About 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one
1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one (PubChem CID 55087439) has the molecular formula C11H16N2O3S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one |
| PubChem CID | 55087439 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H16N2O3S/c14-11-3-1-2-6-13(11)7-5-12-10-4-8-17(15,16)9-10/h1-3,6,10,12H,4-5,7-9H2 |
| InChIKey | MBOAIOIFBHDKJP-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one?
The IUPAC name of 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one (CID 55087439) is 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one.
What is the SMILES notation for 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one?
The canonical SMILES for 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one is O=c1ccccn1CCNC1CCS(=O)(=O)C1.
What is the InChIKey of 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one?
The InChIKey is MBOAIOIFBHDKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S/c14-11-3-1-2-6-13(11)7-5-12-10-4-8-17(15,16)9-10/h1-3,6,10,12H,4-5,7-9H2.
What are the key properties of 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one?
1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one has a molecular weight of 256.33 g/mol, XLogP of -0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(1,1-dioxothiolan-3-yl)amino]ethyl]pyridin-2-one is sourced from PubChem (CID 55087439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).