About pentane-1,4-diamine
pentane-1,4-diamine (PubChem CID 550880) has the molecular formula C5H14N2
and a molecular weight of 102.18 g/mol. Its IUPAC name is pentane-1,4-diamine.
Molecular Properties
| Compound Name | pentane-1,4-diamine |
| PubChem CID | 550880 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | pentane-1,4-diamine |
| SMILES | CC(N)CCCN |
| InChI | InChI=1S/C5H14N2/c1-5(7)3-2-4-6/h5H,2-4,6-7H2,1H3 |
| InChIKey | UEICEJLUNGARHQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-1,4-diamine?
The IUPAC name of pentane-1,4-diamine (CID 550880) is pentane-1,4-diamine.
What is the SMILES notation for pentane-1,4-diamine?
The canonical SMILES for pentane-1,4-diamine is CC(N)CCCN.
What is the InChIKey of pentane-1,4-diamine?
The InChIKey is UEICEJLUNGARHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2/c1-5(7)3-2-4-6/h5H,2-4,6-7H2,1H3.
What are the key properties of pentane-1,4-diamine?
pentane-1,4-diamine has a molecular weight of 102.18 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-1,4-diamine is sourced from PubChem (CID 550880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).