C11H25N3O2S — CID 55088032
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 55088032) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 55088032 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C11H25N3O2S/c1-3-13(4-2)9-6-12-7-10-14-8-5-11-17(14,15)16/h12H,3-11H2,1-2H3 |
| InChIKey | JADKRJYKFIIWJI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|