About 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine
3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine (PubChem CID 55089131) has the molecular formula C13H28N2OS
and a molecular weight of 260.45 g/mol. Its IUPAC name is 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine |
| PubChem CID | 55089131 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine |
| SMILES | CC(C)OCCCNCCN1CCCSCC1 |
| InChI | InChI=1S/C13H28N2OS/c1-13(2)16-10-3-5-14-6-8-15-7-4-11-17-12-9-15/h13-14H,3-12H2,1-2H3 |
| InChIKey | BODRSHDQCNDHGI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine?
The IUPAC name of 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine (CID 55089131) is 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine.
What is the SMILES notation for 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine?
The canonical SMILES for 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine is CC(C)OCCCNCCN1CCCSCC1.
What is the InChIKey of 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine?
The InChIKey is BODRSHDQCNDHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2OS/c1-13(2)16-10-3-5-14-6-8-15-7-4-11-17-12-9-15/h13-14H,3-12H2,1-2H3.
What are the key properties of 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine?
3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine has a molecular weight of 260.45 g/mol, XLogP of 1.83, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxy-N-[2-(1,4-thiazepan-4-yl)ethyl]propan-1-amine is sourced from PubChem (CID 55089131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).