C12H24N2O3S — CID 55089934
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-(2-methylsulfonylethyl)ethanamine (PubChem CID 55089934) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-(2-methylsulfonylethyl)ethanamine.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-(2-methylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 55089934 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-N-(2-methylsulfonylethyl)ethanamine |
| SMILES | CS(=O)(=O)CCNCCN1CCOC2CCCC21 |
| InChI | InChI=1S/C12H24N2O3S/c1-18(15,16)10-6-13-5-7-14-8-9-17-12-4-2-3-11(12)14/h11-13H,2-10H2,1H3 |
| InChIKey | UUTJZFBOBJJDSV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|