C9H17F3N2O2S — CID 55090302
N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 55090302) has the molecular formula C9H17F3N2O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55090302 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCC(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17F3N2O2S/c1-14(4-3-13-7-9(10,11)12)8-2-5-17(15,16)6-8/h8,13H,2-7H2,1H3 |
| InChIKey | UIRBMVCAXJJTOG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|