About N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine
N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine (PubChem CID 55090725) has the molecular formula C10H17N7O
and a molecular weight of 251.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine |
| PubChem CID | 55090725 |
| Molecular Formula | C10H17N7O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine |
| SMILES | COCCNCCN(C)c1cncc2nnnn12 |
| InChI | InChI=1S/C10H17N7O/c1-16(5-3-11-4-6-18-2)10-8-12-7-9-13-14-15-17(9)10/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | XZJUGKNMXPVKMF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
The IUPAC name of N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine (CID 55090725) is N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
The canonical SMILES for N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine is COCCNCCN(C)c1cncc2nnnn12.
What is the InChIKey of N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
The InChIKey is XZJUGKNMXPVKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N7O/c1-16(5-3-11-4-6-18-2)10-8-12-7-9-13-14-15-17(9)10/h7-8,11H,3-6H2,1-2H3.
What are the key properties of N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine?
N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine has a molecular weight of 251.29 g/mol, XLogP of -0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N'-methyl-N'-(tetrazolo[1,5-a]pyrazin-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 55090725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).