C12H20N6 — CID 55090908
N'-methyl-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N-propylethane-1,2-diamine (PubChem CID 55090908) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is N'-methyl-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N-propylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 55090908 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N'-methyl-N'-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1cc(C)nc2ncnn12 |
| InChI | InChI=1S/C12H20N6/c1-4-5-13-6-7-17(3)11-8-10(2)16-12-14-9-15-18(11)12/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | WCSIEOXVBDKBJJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|