C12H17F3N2OS — CID 55091984
N-(2-methoxyethyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-amine (PubChem CID 55091984) has the molecular formula C12H17F3N2OS and a molecular weight of 294.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 55091984 |
| Molecular Formula | C12H17F3N2OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propan-1-amine |
| SMILES | COCCNCC(C)Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H17F3N2OS/c1-9(7-16-5-6-18-2)19-11-4-3-10(8-17-11)12(13,14)15/h3-4,8-9,16H,5-7H2,1-2H3 |
| InChIKey | CQTZOTGHCRBNCR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|