About N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine
N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine (PubChem CID 55092247) has the molecular formula C14H25N3S
and a molecular weight of 267.44 g/mol. Its IUPAC name is N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine |
| PubChem CID | 55092247 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine |
| SMILES | Cc1cc(C)nc(SCCCCNC(C)(C)C)n1 |
| InChI | InChI=1S/C14H25N3S/c1-11-10-12(2)17-13(16-11)18-9-7-6-8-15-14(3,4)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | UVIILWVMUMJGNK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine?
The IUPAC name of N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine (CID 55092247) is N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine.
What is the SMILES notation for N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine?
The canonical SMILES for N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine is Cc1cc(C)nc(SCCCCNC(C)(C)C)n1.
What is the InChIKey of N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine?
The InChIKey is UVIILWVMUMJGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3S/c1-11-10-12(2)17-13(16-11)18-9-7-6-8-15-14(3,4)5/h10,15H,6-9H2,1-5H3.
What are the key properties of N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine?
N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine has a molecular weight of 267.44 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4-(4,6-dimethylpyrimidin-2-yl)sulfanylbutan-1-amine is sourced from PubChem (CID 55092247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).