About N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide
N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide (PubChem CID 55092258) has the molecular formula C10H11F3N4O2
and a molecular weight of 276.22 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide |
| PubChem CID | 55092258 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide |
| SMILES | CC(C(=O)NC1CC1)n1cc(C(=O)C(F)(F)F)nn1 |
| InChI | InChI=1S/C10H11F3N4O2/c1-5(9(19)14-6-2-3-6)17-4-7(15-16-17)8(18)10(11,12)13/h4-6H,2-3H2,1H3,(H,14,19) |
| InChIKey | AXRCOKBLNNNLIJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide?
The IUPAC name of N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide (CID 55092258) is N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide.
What is the SMILES notation for N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide?
The canonical SMILES for N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide is CC(C(=O)NC1CC1)n1cc(C(=O)C(F)(F)F)nn1.
What is the InChIKey of N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide?
The InChIKey is AXRCOKBLNNNLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N4O2/c1-5(9(19)14-6-2-3-6)17-4-7(15-16-17)8(18)10(11,12)13/h4-6H,2-3H2,1H3,(H,14,19).
What are the key properties of N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide?
N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide has a molecular weight of 276.22 g/mol, XLogP of 0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-[4-(2,2,2-trifluoroacetyl)triazol-1-yl]propanamide is sourced from PubChem (CID 55092258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).