C12H16F3NS — CID 55092267
2-benzylsulfanyl-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 55092267) has the molecular formula C12H16F3NS and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | 2-benzylsulfanyl-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 55092267 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-benzylsulfanyl-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CC(CNCC(F)(F)F)SCc1ccccc1 |
| InChI | InChI=1S/C12H16F3NS/c1-10(7-16-9-12(13,14)15)17-8-11-5-3-2-4-6-11/h2-6,10,16H,7-9H2,1H3 |
| InChIKey | PFZAFXXYCBSDCZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |