C11H21F4NO — CID 55092870
4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pentan-1-amine (PubChem CID 55092870) has the molecular formula C11H21F4NO and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pentan-1-amine.
| Compound Name | 4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 55092870 |
| Molecular Formula | C11H21F4NO |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]pentan-1-amine |
| SMILES | CC(C)CCCNCCOCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H21F4NO/c1-9(2)4-3-5-16-6-7-17-8-11(14,15)10(12)13/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | OEHQSARIVOPDDT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|