C10H12BrF4NOS — CID 55092916
N-[(4-bromothiophen-2-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 55092916) has the molecular formula C10H12BrF4NOS and a molecular weight of 350.18 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 55092916 |
| Molecular Formula | C10H12BrF4NOS |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | FC(F)C(F)(F)COCCNCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H12BrF4NOS/c11-7-3-8(18-5-7)4-16-1-2-17-6-10(14,15)9(12)13/h3,5,9,16H,1-2,4,6H2 |
| InChIKey | YODLYPSBTUKQHK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|